AKOS 207-07 - Names and Identifiers
Name | 4-Chloro-2-oxindole
|
Synonyms | AKOS 207-07 4-Chlorooxindole 4-CHLOROOXINDOLE 4-CHLORO-2-OXINDOLE 4-Chloro-2-oxindole 4-Chloro-2-oxoindole 4-CHLORO-1,3-DIHYDRO-INDOL-2-ONE 4-Chloro-1,3-Dihydro-Indol-2-One 4-Chloro-1,3-dihydro-2H-indol-2-one 4-CHLORO-1,3-DIHYDRO-2H-INDOL-2-ONE 4-chloro-2,3-dihydro-1H-indol-2-one 4-Chloro-2,3-dihydro-1H-indole-2-one 4-Chloro-2-oxindole 4-Chloro-1,3-dihydro-indol-2-one in stock Factory
|
CAS | 20870-77-3
|
InChI | InChI=1/C8H6ClNO/c9-6-2-1-3-7-5(6)4-8(11)10-7/h1-3H,4H2,(H,10,11) |
AKOS 207-07 - Physico-chemical Properties
Molecular Formula | C8H6ClNO
|
Molar Mass | 167.59 |
Density | 1.362±0.06 g/cm3(Predicted) |
Melting Point | 206-208° |
Boling Point | 340.3±42.0 °C(Predicted) |
Flash Point | 159.6°C |
Vapor Presure | 8.66E-05mmHg at 25°C |
pKa | 13.27±0.20(Predicted) |
Storage Condition | 2-8°C |
Refractive Index | 1.601 |
AKOS 207-07 - Risk and Safety
Hazard Symbols | Xi - Irritant
|
Hazard Class | IRRITANT |
AKOS 207-07 - Introduction
4-Chloro-2-oxindole is an organic compound with the chemical formula C8H5ClNO. Its properties are as follows:
1. Appearance: colorless crystal or white powder.
2. Melting Point: about 118-122 ℃.
3. Boiling point: About 336 ℃.
4. Solubility: slightly soluble in water, soluble in organic solvents such as ethanol, ether, etc.
4-Chloro-2-oxindole is commonly used in organic synthesis and pharmaceutical research. It can be used as a bactericide, fungicide, antiviral drugs and alkaloid synthesis intermediates.
There are usually two ways to make 4-Chloro-2-oxindole:
1. Indole reacts with thionyl chloride to obtain 4-chloroindole, which is then oxidized in the presence of sodium hydroxide to generate 4-chloroo-2-oxindole.
2. Starting from indole, 4-Chloro-2-oxindole is prepared by chlorination or ozonation.
Note the following safety information when using and handling 4-Chloro-2-oxindole:
1. Avoid inhalation of dust and contact with skin, eyes and mucous membranes.
2. Should wear protective glasses, protective gloves and protective clothing in use.
3. Operate in a well-ventilated place and avoid inhaling its vapor.
4. In case of accidental contact, please rinse the skin with plenty of water and seek medical attention immediately.
5. Waste disposal should follow the corresponding environmental regulations.
Last Update:2024-04-09 19:05:47